2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid

C10H17NO4S — CID 103255038

IUPAC2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid
SMILESCCCCC(NC1C=CS(=O)(=O)C1)C(=O)O
InChIInChI=1S/C10H17NO4S/c1-2-3-4-9(10(12)13)11-8-5-6-16(14,15)7-8/h5-6,8-9,11H,2-4,7H2,1H3,(H,12,13)
InChIKeyFWLXPPYPRMHHGL-UHFFFAOYSA-N
MW247.32 g/mol
LogP0.53
Rot. Bonds6

About 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid

2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid (PubChem CID 103255038) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid.

Molecular Properties

Compound Name2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid
PubChem CID103255038
Molecular FormulaC10H17NO4S
Molecular Weight247.32 g/mol
Exact Mass247.09
IUPAC Name2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid
SMILESCCCCC(NC1C=CS(=O)(=O)C1)C(=O)O
InChIInChI=1S/C10H17NO4S/c1-2-3-4-9(10(12)13)11-8-5-6-16(14,15)7-8/h5-6,8-9,11H,2-4,7H2,1H3,(H,12,13)
InChIKeyFWLXPPYPRMHHGL-UHFFFAOYSA-N
XLogP0.53
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.32
LogP ≤ 50.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid?
The IUPAC name of 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid (CID 103255038) is 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid.
What is the SMILES notation for 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid?
The canonical SMILES for 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid is CCCCC(NC1C=CS(=O)(=O)C1)C(=O)O.
What is the InChIKey of 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid?
The InChIKey is FWLXPPYPRMHHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4S/c1-2-3-4-9(10(12)13)11-8-5-6-16(14,15)7-8/h5-6,8-9,11H,2-4,7H2,1H3,(H,12,13).
What are the key properties of 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid?
2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid has a molecular weight of 247.32 g/mol, XLogP of 0.53, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid is sourced from PubChem (CID 103255038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).