C10H17NO4S — CID 103255038
2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid (PubChem CID 103255038) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid.
| Compound Name | 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 103255038 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]hexanoic acid |
| SMILES | CCCCC(NC1C=CS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C10H17NO4S/c1-2-3-4-9(10(12)13)11-8-5-6-16(14,15)7-8/h5-6,8-9,11H,2-4,7H2,1H3,(H,12,13) |
| InChIKey | FWLXPPYPRMHHGL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |