C10H19NO5S — CID 106990097
1-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106990097) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106990097 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO5S/c1-15-3-4-16-7-10(12)6-11-9-2-5-17(13,14)8-9/h2,5,9-12H,3-4,6-8H2,1H3 |
| InChIKey | USJWPGAYKIITMS-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|