C10H15NO4S — CID 103255036
(Z)-4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-2-ethylbut-2-enoic acid (PubChem CID 103255036) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (Z)-4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103255036 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (Z)-4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/CNC1C=CS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C10H15NO4S/c1-2-8(10(12)13)3-5-11-9-4-6-16(14,15)7-9/h3-4,6,9,11H,2,5,7H2,1H3,(H,12,13)/b8-3- |
| InChIKey | SEGHXXBJLAXCJG-BAQGIRSFSA-N |
| XLogP | 0.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|