C9H15NO4S — CID 103231370
4-[(1,1-dioxothiolan-3-yl)amino]-2-methylbut-2-enoic acid (PubChem CID 103231370) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)amino]-2-methylbut-2-enoic acid.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103231370 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)amino]-2-methylbut-2-enoic acid |
| SMILES | CC(=CCNC1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C9H15NO4S/c1-7(9(11)12)2-4-10-8-3-5-15(13,14)6-8/h2,8,10H,3-6H2,1H3,(H,11,12) |
| InChIKey | YUCAFUCWKLMSMD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|