C10H17NO4S — CID 77005829
4-[(1,1-dioxothiolan-3-yl)-methylamino]-3-methylbut-2-enoic acid (PubChem CID 77005829) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-methylamino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77005829 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO4S/c1-8(5-10(12)13)6-11(2)9-3-4-16(14,15)7-9/h5,9H,3-4,6-7H2,1-2H3,(H,12,13) |
| InChIKey | PGFLUCWGSRDMPU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|