C10H19NO4S — CID 103242059
2-ethyl-4-(3-methylsulfonylpropylamino)but-2-enoic acid (PubChem CID 103242059) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-ethyl-4-(3-methylsulfonylpropylamino)but-2-enoic acid.
| Compound Name | 2-ethyl-4-(3-methylsulfonylpropylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103242059 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-ethyl-4-(3-methylsulfonylpropylamino)but-2-enoic acid |
| SMILES | CCC(=CCNCCCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H19NO4S/c1-3-9(10(12)13)5-7-11-6-4-8-16(2,14)15/h5,11H,3-4,6-8H2,1-2H3,(H,12,13) |
| InChIKey | ZEDPHTLNOAPSKR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|