About diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate
diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate (PubChem CID 141188243) has the molecular formula C13H27NO5S
and a molecular weight of 309.43 g/mol. Its IUPAC name is diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate.
Molecular Properties
| Compound Name | diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate |
| PubChem CID | 141188243 |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate |
| SMILES | CCC=C(C)C(=O)[O-].CC[NH+](CC)CCCS(=O)(=O)O |
| InChI | InChI=1S/C7H17NO3S.C6H10O2/c1-3-8(4-2)6-5-7-12(9,10)11;1-3-4-5(2)6(7)8/h3-7H2,1-2H3,(H,9,10,11);4H,3H2,1-2H3,(H,7,8) |
| InChIKey | SXQJJUFZKRJMDP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate?
The IUPAC name of diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate (CID 141188243) is diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate.
What is the SMILES notation for diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate?
The canonical SMILES for diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate is CCC=C(C)C(=O)[O-].CC[NH+](CC)CCCS(=O)(=O)O.
What is the InChIKey of diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate?
The InChIKey is SXQJJUFZKRJMDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO3S.C6H10O2/c1-3-8(4-2)6-5-7-12(9,10)11;1-3-4-5(2)6(7)8/h3-7H2,1-2H3,(H,9,10,11);4H,3H2,1-2H3,(H,7,8).
What are the key properties of diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate?
diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate has a molecular weight of 309.43 g/mol, XLogP of -0.72, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(3-sulfopropyl)azanium;2-methylpent-2-enoate is sourced from PubChem (CID 141188243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).