C9H17NO5S — CID 139762164
2-[2-(dimethylazaniumyl)ethyl]-5-sulfopent-2-enoate (PubChem CID 139762164) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[2-(dimethylazaniumyl)ethyl]-5-sulfopent-2-enoate.
| Compound Name | 2-[2-(dimethylazaniumyl)ethyl]-5-sulfopent-2-enoate |
|---|---|
| PubChem CID | 139762164 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[2-(dimethylazaniumyl)ethyl]-5-sulfopent-2-enoate |
| SMILES | C[NH+](C)CCC(=CCCS(=O)(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C9H17NO5S/c1-10(2)6-5-8(9(11)12)4-3-7-16(13,14)15/h4H,3,5-7H2,1-2H3,(H,11,12)(H,13,14,15) |
| InChIKey | AYOKQFIGCWGPFH-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|