C11H19NaO5S — CID 173461864
sodium 2-(3-sulfopropylidene)octanoate (PubChem CID 173461864) has the molecular formula C11H19NaO5S and a molecular weight of 286.32 g/mol. Its IUPAC name is sodium 2-(3-sulfopropylidene)octanoate.
| Compound Name | sodium 2-(3-sulfopropylidene)octanoate |
|---|---|
| PubChem CID | 173461864 |
| Molecular Formula | C11H19NaO5S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | sodium 2-(3-sulfopropylidene)octanoate |
| SMILES | CCCCCCC(=CCCS(=O)(=O)O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H20O5S.Na/c1-2-3-4-5-7-10(11(12)13)8-6-9-17(14,15)16;/h8H,2-7,9H2,1H3,(H,12,13)(H,14,15,16);/q;+1/p-1 |
| InChIKey | AZTYLJQVMFVFRK-UHFFFAOYSA-M |
| XLogP | -2.09 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|