C25H51NO2 — CID 141205951
azanium 11,11-diethyl-2-octyltridec-2-enoate (PubChem CID 141205951) has the molecular formula C25H51NO2 and a molecular weight of 397.69 g/mol. Its IUPAC name is azanium 11,11-diethyl-2-octyltridec-2-enoate.
| Compound Name | azanium 11,11-diethyl-2-octyltridec-2-enoate |
|---|---|
| PubChem CID | 141205951 |
| Molecular Formula | C25H51NO2 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.39 |
| IUPAC Name | azanium 11,11-diethyl-2-octyltridec-2-enoate |
| SMILES | CCCCCCCCC(=CCCCCCCCC(CC)(CC)CC)C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C25H48O2.H3N/c1-5-9-10-11-14-17-20-23(24(26)27)21-18-15-12-13-16-19-22-25(6-2,7-3)8-4;/h21H,5-20,22H2,1-4H3,(H,26,27);1H3 |
| InChIKey | YAGRLWIEABIXLN-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|