About potassium;2-aminoethanesulfonic acid;dodecanoate
potassium;2-aminoethanesulfonic acid;dodecanoate (PubChem CID 87320369) has the molecular formula C14H30KNO5S
and a molecular weight of 363.56 g/mol. Its IUPAC name is potassium;2-aminoethanesulfonic acid;dodecanoate.
Molecular Properties
| Compound Name | potassium;2-aminoethanesulfonic acid;dodecanoate |
| PubChem CID | 87320369 |
| Molecular Formula | C14H30KNO5S |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | potassium;2-aminoethanesulfonic acid;dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)[O-].NCCS(=O)(=O)O.[K+] |
| InChI | InChI=1S/C12H24O2.C2H7NO3S.K/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;3-1-2-7(4,5)6;/h2-11H2,1H3,(H,13,14);1-3H2,(H,4,5,6);/q;;+1/p-1 |
| InChIKey | YXUKIOYEWGMHBJ-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-aminoethanesulfonic acid;dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-aminoethanesulfonic acid;dodecanoate?
The IUPAC name of potassium;2-aminoethanesulfonic acid;dodecanoate (CID 87320369) is potassium;2-aminoethanesulfonic acid;dodecanoate.
What is the SMILES notation for potassium;2-aminoethanesulfonic acid;dodecanoate?
The canonical SMILES for potassium;2-aminoethanesulfonic acid;dodecanoate is CCCCCCCCCCCC(=O)[O-].NCCS(=O)(=O)O.[K+].
What is the InChIKey of potassium;2-aminoethanesulfonic acid;dodecanoate?
The InChIKey is YXUKIOYEWGMHBJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O2.C2H7NO3S.K/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;3-1-2-7(4,5)6;/h2-11H2,1H3,(H,13,14);1-3H2,(H,4,5,6);/q;;+1/p-1.
What are the key properties of potassium;2-aminoethanesulfonic acid;dodecanoate?
potassium;2-aminoethanesulfonic acid;dodecanoate has a molecular weight of 363.56 g/mol, XLogP of -1.51, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-aminoethanesulfonic acid;dodecanoate is sourced from PubChem (CID 87320369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).