About silver octanoate
silver octanoate (PubChem CID 15250566) has the molecular formula C8H15AgO2
and a molecular weight of 251.07 g/mol. Its IUPAC name is silver octanoate.
Molecular Properties
| Compound Name | silver octanoate |
| PubChem CID | 15250566 |
| Molecular Formula | C8H15AgO2 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | silver octanoate |
| SMILES | CCCCCCCC(=O)[O-].[Ag+] |
| InChI | InChI=1S/C8H16O2.Ag/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | ZYPJJPHRTZPKKY-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze silver octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver octanoate?
The IUPAC name of silver octanoate (CID 15250566) is silver octanoate.
What is the SMILES notation for silver octanoate?
The canonical SMILES for silver octanoate is CCCCCCCC(=O)[O-].[Ag+].
What is the InChIKey of silver octanoate?
The InChIKey is ZYPJJPHRTZPKKY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Ag/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of silver octanoate?
silver octanoate has a molecular weight of 251.07 g/mol, XLogP of 1.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver octanoate is sourced from PubChem (CID 15250566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).