About calcium bis(4-sulfobutanoate)
calcium bis(4-sulfobutanoate) (PubChem CID 87400000) has the molecular formula C8H14CaO10S2
and a molecular weight of 374.40 g/mol. Its IUPAC name is calcium bis(4-sulfobutanoate).
Molecular Properties
| Compound Name | calcium bis(4-sulfobutanoate) |
| PubChem CID | 87400000 |
| Molecular Formula | C8H14CaO10S2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | calcium bis(4-sulfobutanoate) |
| SMILES | O=C([O-])CCCS(=O)(=O)O.O=C([O-])CCCS(=O)(=O)O.[Ca+2] |
| InChI | InChI=1S/2C4H8O5S.Ca/c2*5-4(6)2-1-3-10(7,8)9;/h2*1-3H2,(H,5,6)(H,7,8,9);/q;;+2/p-2 |
| InChIKey | CSDSFPPSEAZYPB-UHFFFAOYSA-L |
| XLogP | -3.57 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(4-sulfobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(4-sulfobutanoate)?
The IUPAC name of calcium bis(4-sulfobutanoate) (CID 87400000) is calcium bis(4-sulfobutanoate).
What is the SMILES notation for calcium bis(4-sulfobutanoate)?
The canonical SMILES for calcium bis(4-sulfobutanoate) is O=C([O-])CCCS(=O)(=O)O.O=C([O-])CCCS(=O)(=O)O.[Ca+2].
What is the InChIKey of calcium bis(4-sulfobutanoate)?
The InChIKey is CSDSFPPSEAZYPB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H8O5S.Ca/c2*5-4(6)2-1-3-10(7,8)9;/h2*1-3H2,(H,5,6)(H,7,8,9);/q;;+2/p-2.
What are the key properties of calcium bis(4-sulfobutanoate)?
calcium bis(4-sulfobutanoate) has a molecular weight of 374.40 g/mol, XLogP of -3.57, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(4-sulfobutanoate) is sourced from PubChem (CID 87400000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).