C11H16Na2O10S2 — CID 87832550
disodium;2-(1,7-disulfoheptan-4-ylidene)butanedioate (PubChem CID 87832550) has the molecular formula C11H16Na2O10S2 and a molecular weight of 418.35 g/mol. Its IUPAC name is disodium;2-(1,7-disulfoheptan-4-ylidene)butanedioate.
| Compound Name | disodium;2-(1,7-disulfoheptan-4-ylidene)butanedioate |
|---|---|
| PubChem CID | 87832550 |
| Molecular Formula | C11H16Na2O10S2 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | disodium;2-(1,7-disulfoheptan-4-ylidene)butanedioate |
| SMILES | O=C([O-])CC(C(=O)[O-])=C(CCCS(=O)(=O)O)CCCS(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C11H18O10S2.2Na/c12-10(13)7-9(11(14)15)8(3-1-5-22(16,17)18)4-2-6-23(19,20)21;;/h1-7H2,(H,12,13)(H,14,15)(H,16,17,18)(H,19,20,21);;/q;2*+1/p-2 |
| InChIKey | AGZAXHBZKNPYSQ-UHFFFAOYSA-L |
| XLogP | -8.48 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | -8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|