C10H19NO5S — CID 174230057
5-[dimethyl(2-sulfoethyl)azaniumyl]-2-methylpent-2-enoate (PubChem CID 174230057) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 5-[dimethyl(2-sulfoethyl)azaniumyl]-2-methylpent-2-enoate.
| Compound Name | 5-[dimethyl(2-sulfoethyl)azaniumyl]-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 174230057 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-[dimethyl(2-sulfoethyl)azaniumyl]-2-methylpent-2-enoate |
| SMILES | CC(=CCC[N+](C)(C)CCS(=O)(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C10H19NO5S/c1-9(10(12)13)5-4-6-11(2,3)7-8-17(14,15)16/h5H,4,6-8H2,1-3H3,(H-,12,13,14,15,16) |
| InChIKey | DPQQJUBNGDYLQE-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|