C12H14O4-2 — CID 22792936
(2E,5E,8E)-2,9-dimethyldeca-2,5,8-trienedioate (PubChem CID 22792936) has the molecular formula C12H14O4-2 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2E,5E,8E)-2,9-dimethyldeca-2,5,8-trienedioate.
| Compound Name | (2E,5E,8E)-2,9-dimethyldeca-2,5,8-trienedioate |
|---|---|
| PubChem CID | 22792936 |
| Molecular Formula | C12H14O4-2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2E,5E,8E)-2,9-dimethyldeca-2,5,8-trienedioate |
| SMILES | C/C(=C\C/C=C/C/C=C(\C)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C12H16O4/c1-9(11(13)14)7-5-3-4-6-8-10(2)12(15)16/h3-4,7-8H,5-6H2,1-2H3,(H,13,14)(H,15,16)/p-2/b4-3+,9-7+,10-8+ |
| InChIKey | PERDKHBYOBPJQW-VCVUDNKTSA-L |
| XLogP | -0.28 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|