About diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride
diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride (PubChem CID 141088359) has the molecular formula C8H20ClN3O2
and a molecular weight of 225.72 g/mol. Its IUPAC name is diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride.
Molecular Properties
| Compound Name | diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride |
| PubChem CID | 141088359 |
| Molecular Formula | C8H20ClN3O2 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride |
| SMILES | C=CCNCC=C(C)C(=O)[O-].[Cl-].[NH4+].[NH4+] |
| InChI | InChI=1S/C8H13NO2.ClH.2H3N/c1-3-5-9-6-4-7(2)8(10)11;;;/h3-4,9H,1,5-6H2,2H3,(H,10,11);1H;2*1H3 |
| InChIKey | WOLFMNZFBUTVQY-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride?
The IUPAC name of diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride (CID 141088359) is diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride.
What is the SMILES notation for diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride?
The canonical SMILES for diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride is C=CCNCC=C(C)C(=O)[O-].[Cl-].[NH4+].[NH4+].
What is the InChIKey of diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride?
The InChIKey is WOLFMNZFBUTVQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.ClH.2H3N/c1-3-5-9-6-4-7(2)8(10)11;;;/h3-4,9H,1,5-6H2,2H3,(H,10,11);1H;2*1H3.
What are the key properties of diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride?
diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride has a molecular weight of 225.72 g/mol, XLogP of -2.79, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-methyl-4-(prop-2-enylamino)but-2-enoate;chloride is sourced from PubChem (CID 141088359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).