About 6-iodo-2-methylhexa-2,5-dienoic acid
6-iodo-2-methylhexa-2,5-dienoic acid (PubChem CID 173232639) has the molecular formula C7H9IO2
and a molecular weight of 252.05 g/mol. Its IUPAC name is 6-iodo-2-methylhexa-2,5-dienoic acid.
Molecular Properties
| Compound Name | 6-iodo-2-methylhexa-2,5-dienoic acid |
| PubChem CID | 173232639 |
| Molecular Formula | C7H9IO2 |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 6-iodo-2-methylhexa-2,5-dienoic acid |
| SMILES | CC(=CCC=CI)C(=O)O |
| InChI | InChI=1S/C7H9IO2/c1-6(7(9)10)4-2-3-5-8/h3-5H,2H2,1H3,(H,9,10) |
| InChIKey | NGJZRVNFVSBHSM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2-methylhexa-2,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2-methylhexa-2,5-dienoic acid?
The IUPAC name of 6-iodo-2-methylhexa-2,5-dienoic acid (CID 173232639) is 6-iodo-2-methylhexa-2,5-dienoic acid.
What is the SMILES notation for 6-iodo-2-methylhexa-2,5-dienoic acid?
The canonical SMILES for 6-iodo-2-methylhexa-2,5-dienoic acid is CC(=CCC=CI)C(=O)O.
What is the InChIKey of 6-iodo-2-methylhexa-2,5-dienoic acid?
The InChIKey is NGJZRVNFVSBHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IO2/c1-6(7(9)10)4-2-3-5-8/h3-5H,2H2,1H3,(H,9,10).
What are the key properties of 6-iodo-2-methylhexa-2,5-dienoic acid?
6-iodo-2-methylhexa-2,5-dienoic acid has a molecular weight of 252.05 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2-methylhexa-2,5-dienoic acid is sourced from PubChem (CID 173232639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).