About 2-methyl-6-sulfohex-2-enoic acid;polane
2-methyl-6-sulfohex-2-enoic acid;polane (PubChem CID 173373712) has the molecular formula C7H14O5PoS
and a molecular weight of 419.25 g/mol. Its IUPAC name is 2-methyl-6-sulfohex-2-enoic acid;polane.
Molecular Properties
| Compound Name | 2-methyl-6-sulfohex-2-enoic acid;polane |
| PubChem CID | 173373712 |
| Molecular Formula | C7H14O5PoS |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-methyl-6-sulfohex-2-enoic acid;polane |
| SMILES | CC(=CCCCS(=O)(=O)O)C(=O)O.[PoH2] |
| InChI | InChI=1S/C7H12O5S.Po.2H/c1-6(7(8)9)4-2-3-5-13(10,11)12;;;/h4H,2-3,5H2,1H3,(H,8,9)(H,10,11,12);;; |
| InChIKey | YGFOXATXWMEEEL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-sulfohex-2-enoic acid;polane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-sulfohex-2-enoic acid;polane?
The IUPAC name of 2-methyl-6-sulfohex-2-enoic acid;polane (CID 173373712) is 2-methyl-6-sulfohex-2-enoic acid;polane.
What is the SMILES notation for 2-methyl-6-sulfohex-2-enoic acid;polane?
The canonical SMILES for 2-methyl-6-sulfohex-2-enoic acid;polane is CC(=CCCCS(=O)(=O)O)C(=O)O.[PoH2].
What is the InChIKey of 2-methyl-6-sulfohex-2-enoic acid;polane?
The InChIKey is YGFOXATXWMEEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O5S.Po.2H/c1-6(7(8)9)4-2-3-5-13(10,11)12;;;/h4H,2-3,5H2,1H3,(H,8,9)(H,10,11,12);;;.
What are the key properties of 2-methyl-6-sulfohex-2-enoic acid;polane?
2-methyl-6-sulfohex-2-enoic acid;polane has a molecular weight of 419.25 g/mol, XLogP of -0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-sulfohex-2-enoic acid;polane is sourced from PubChem (CID 173373712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).