2-methyl-7-sulfohept-2-enoic acid

C8H14O5S — CID 57198486

IUPAC2-methyl-7-sulfohept-2-enoic acid
SMILESCC(=CCCCCS(=O)(=O)O)C(=O)O
InChIInChI=1S/C8H14O5S/c1-7(8(9)10)5-3-2-4-6-14(11,12)13/h5H,2-4,6H2,1H3,(H,9,10)(H,11,12,13)
InChIKeyPPLCBWUIJMSENA-UHFFFAOYSA-N
MW222.26 g/mol
LogP1.08
Rot. Bonds6

About 2-methyl-7-sulfohept-2-enoic acid

2-methyl-7-sulfohept-2-enoic acid (PubChem CID 57198486) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-methyl-7-sulfohept-2-enoic acid.

Molecular Properties

Compound Name2-methyl-7-sulfohept-2-enoic acid
PubChem CID57198486
Molecular FormulaC8H14O5S
Molecular Weight222.26 g/mol
Exact Mass222.06
IUPAC Name2-methyl-7-sulfohept-2-enoic acid
SMILESCC(=CCCCCS(=O)(=O)O)C(=O)O
InChIInChI=1S/C8H14O5S/c1-7(8(9)10)5-3-2-4-6-14(11,12)13/h5H,2-4,6H2,1H3,(H,9,10)(H,11,12,13)
InChIKeyPPLCBWUIJMSENA-UHFFFAOYSA-N
XLogP1.08
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.26
LogP ≤ 51.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methyl-7-sulfohept-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-methyl-6-sulfohex-2-enoic acid
CID 53446312
2-methyl-6-sulfohex-2-enoic acid;polane
CID 173373712
2,13-dimethyltetradeca-2,12-dienedioic acid
CID 173279289
potassium (E)-2-methyl-6-sulfohex-2-enoate
CID 87119545
(E)-7-bromo-2-methylhept-2-enoic acid
CID 87183825
(Z)-2-methylnon-2-enoic acid
CID 19098031
(E)-2-methylnonacos-2-enoic acid
CID 87108662
2-methylhentriacont-2-enoic acid
CID 141160211
2-methylheptadec-2-enoic acid;hydrofluoride
CID 174883773
8-amino-2-methyloct-2-enoic acid
CID 90963841
(E)-2-methylnon-2-enedioic acid
CID 87072449
methane;2-methyl-6-silylhex-2-enoic acid
CID 173490194

Frequently Asked Questions

What is the IUPAC name of 2-methyl-7-sulfohept-2-enoic acid?
The IUPAC name of 2-methyl-7-sulfohept-2-enoic acid (CID 57198486) is 2-methyl-7-sulfohept-2-enoic acid.
What is the SMILES notation for 2-methyl-7-sulfohept-2-enoic acid?
The canonical SMILES for 2-methyl-7-sulfohept-2-enoic acid is CC(=CCCCCS(=O)(=O)O)C(=O)O.
What is the InChIKey of 2-methyl-7-sulfohept-2-enoic acid?
The InChIKey is PPLCBWUIJMSENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5S/c1-7(8(9)10)5-3-2-4-6-14(11,12)13/h5H,2-4,6H2,1H3,(H,9,10)(H,11,12,13).
What are the key properties of 2-methyl-7-sulfohept-2-enoic acid?
2-methyl-7-sulfohept-2-enoic acid has a molecular weight of 222.26 g/mol, XLogP of 1.08, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-sulfohept-2-enoic acid is sourced from PubChem (CID 57198486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).