C11H22NO6S+ — CID 174230054
4-carboxypent-3-enyl-(3-hydroxy-3-sulfopropyl)-dimethylazanium (PubChem CID 174230054) has the molecular formula C11H22NO6S+ and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-carboxypent-3-enyl-(3-hydroxy-3-sulfopropyl)-dimethylazanium.
| Compound Name | 4-carboxypent-3-enyl-(3-hydroxy-3-sulfopropyl)-dimethylazanium |
|---|---|
| PubChem CID | 174230054 |
| Molecular Formula | C11H22NO6S+ |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-carboxypent-3-enyl-(3-hydroxy-3-sulfopropyl)-dimethylazanium |
| SMILES | CC(=CCC[N+](C)(C)CCC(O)S(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H21NO6S/c1-9(11(14)15)5-4-7-12(2,3)8-6-10(13)19(16,17)18/h5,10,13H,4,6-8H2,1-3H3,(H-,14,15,16,17,18)/p+1 |
| InChIKey | MIAKMXDFMSGTEH-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|