C8H9Cl5O2 — CID 101132735
[(2S,3S,5R,6R)-2,3,4,5,6-pentachlorocyclohexyl] acetate (PubChem CID 101132735) has the molecular formula C8H9Cl5O2 and a molecular weight of 314.42 g/mol. Its IUPAC name is [(2S,3S,5R,6R)-2,3,4,5,6-pentachlorocyclohexyl] acetate.
| Compound Name | [(2S,3S,5R,6R)-2,3,4,5,6-pentachlorocyclohexyl] acetate |
|---|---|
| PubChem CID | 101132735 |
| Molecular Formula | C8H9Cl5O2 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 311.90 |
| IUPAC Name | [(2S,3S,5R,6R)-2,3,4,5,6-pentachlorocyclohexyl] acetate |
| SMILES | CC(=O)OC1[C@@H](Cl)[C@@H](Cl)C(Cl)[C@@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C8H9Cl5O2/c1-2(14)15-8-6(12)4(10)3(9)5(11)7(8)13/h3-8H,1H3/t3?,4-,5+,6-,7+,8? |
| InChIKey | XGMLQHVCPYDYQJ-IZKSUQRTSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|