C9H12Cl2O5 — CID 54124418
[(2R,3R,4S,5R)-3-acetyloxy-4,5-dichlorooxolan-2-yl]methyl acetate (PubChem CID 54124418) has the molecular formula C9H12Cl2O5 and a molecular weight of 271.10 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3-acetyloxy-4,5-dichlorooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3-acetyloxy-4,5-dichlorooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54124418 |
| Molecular Formula | C9H12Cl2O5 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | [(2R,3R,4S,5R)-3-acetyloxy-4,5-dichlorooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Cl)[C@@H](Cl)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C9H12Cl2O5/c1-4(12)14-3-6-8(15-5(2)13)7(10)9(11)16-6/h6-9H,3H2,1-2H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | NPYQOIAUCNYQCN-XAVMHZPKSA-N |
| XLogP | 1.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|