C16H20Cl2O8 — CID 91526415
[(2R,3S,5S,6R,7S,8S)-3,5,6-triacetyloxy-7,8-dichloro-2-bicyclo[2.2.2]octanyl] acetate (PubChem CID 91526415) has the molecular formula C16H20Cl2O8 and a molecular weight of 411.23 g/mol. Its IUPAC name is [(2R,3S,5S,6R,7S,8S)-3,5,6-triacetyloxy-7,8-dichloro-2-bicyclo[2.2.2]octanyl] acetate.
| Compound Name | [(2R,3S,5S,6R,7S,8S)-3,5,6-triacetyloxy-7,8-dichloro-2-bicyclo[2.2.2]octanyl] acetate |
|---|---|
| PubChem CID | 91526415 |
| Molecular Formula | C16H20Cl2O8 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | [(2R,3S,5S,6R,7S,8S)-3,5,6-triacetyloxy-7,8-dichloro-2-bicyclo[2.2.2]octanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C2[C@@H](OC(C)=O)[C@@H](OC(C)=O)C([C@H](Cl)[C@H]2Cl)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H20Cl2O8/c1-5(19)23-13-9-11(17)12(18)10(14(13)24-6(2)20)16(26-8(4)22)15(9)25-7(3)21/h9-16H,1-4H3/t9?,10?,11-,12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | BIJLZWUZTXDGQR-UYTRYQOYSA-N |
| XLogP | 1.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|