C7H12ClNO4 — CID 70192411
[(2R,3R,4S)-5-amino-4-chloro-2-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 70192411) has the molecular formula C7H12ClNO4 and a molecular weight of 209.63 g/mol. Its IUPAC name is [(2R,3R,4S)-5-amino-4-chloro-2-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S)-5-amino-4-chloro-2-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 70192411 |
| Molecular Formula | C7H12ClNO4 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | [(2R,3R,4S)-5-amino-4-chloro-2-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](Cl)C(N)O[C@@H]1CO |
| InChI | InChI=1S/C7H12ClNO4/c1-3(11)12-6-4(2-10)13-7(9)5(6)8/h4-7,10H,2,9H2,1H3/t4-,5+,6-,7?/m1/s1 |
| InChIKey | SSMYXPNHECLIGL-JFRCYRBUSA-N |
| XLogP | -0.80 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|