C12H20N2O7 — CID 129227864
[5-acetamido-4-acetyloxy-6-amino-2-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 129227864) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is [5-acetamido-4-acetyloxy-6-amino-2-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [5-acetamido-4-acetyloxy-6-amino-2-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 129227864 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [5-acetamido-4-acetyloxy-6-amino-2-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)NC1C(N)OC(CO)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C12H20N2O7/c1-5(16)14-9-11(20-7(3)18)10(19-6(2)17)8(4-15)21-12(9)13/h8-12,15H,4,13H2,1-3H3,(H,14,16) |
| InChIKey | CILIKUZZECLFLA-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |