C14H23NO6 — CID 129087954
[(3S,4S)-5-acetamido-4-acetyloxy-2-ethyl-6-methyloxan-3-yl] acetate (PubChem CID 129087954) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(3S,4S)-5-acetamido-4-acetyloxy-2-ethyl-6-methyloxan-3-yl] acetate.
| Compound Name | [(3S,4S)-5-acetamido-4-acetyloxy-2-ethyl-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 129087954 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | [(3S,4S)-5-acetamido-4-acetyloxy-2-ethyl-6-methyloxan-3-yl] acetate |
| SMILES | CCC1OC(C)C(NC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H23NO6/c1-6-11-13(20-9(4)17)14(21-10(5)18)12(7(2)19-11)15-8(3)16/h7,11-14H,6H2,1-5H3,(H,15,16)/t7?,11?,12?,13-,14-/m0/s1 |
| InChIKey | XYIKMXNGLZXULU-BKGJPPEXSA-N |
| XLogP | 0.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |