C14H21NO6 — CID 59972998
[(3S)-5-acetamido-2-ethyl-3-ethynylperoxy-6-methyloxan-4-yl] acetate (PubChem CID 59972998) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is [(3S)-5-acetamido-2-ethyl-3-ethynylperoxy-6-methyloxan-4-yl] acetate.
| Compound Name | [(3S)-5-acetamido-2-ethyl-3-ethynylperoxy-6-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 59972998 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(3S)-5-acetamido-2-ethyl-3-ethynylperoxy-6-methyloxan-4-yl] acetate |
| SMILES | C#COO[C@H]1C(CC)OC(C)C(NC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H21NO6/c1-6-11-13(21-18-7-2)14(20-10(5)17)12(8(3)19-11)15-9(4)16/h2,8,11-14H,6H2,1,3-5H3,(H,15,16)/t8?,11?,12?,13-,14?/m0/s1 |
| InChIKey | XEMTVWFRSCGIEW-LZZQSMCWSA-N |
| XLogP | 0.53 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|