C25H44N2O7 — CID 71209686
N-[(2S,5S,6S)-2-[(3R,4R,6R)-5-acetamido-2-ethyl-6-methyl-4-[(2R)-3-oxobutan-2-yl]oxyoxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl]acetamide (PubChem CID 71209686) has the molecular formula C25H44N2O7 and a molecular weight of 484.63 g/mol. Its IUPAC name is N-[(2S,5S,6S)-2-[(3R,4R,6R)-5-acetamido-2-ethyl-6-methyl-4-[(2R)-3-oxobutan-2-yl]oxyoxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl]acetamide.
| Compound Name | N-[(2S,5S,6S)-2-[(3R,4R,6R)-5-acetamido-2-ethyl-6-methyl-4-[(2R)-3-oxobutan-2-yl]oxyoxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 71209686 |
| Molecular Formula | C25H44N2O7 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | N-[(2S,5S,6S)-2-[(3R,4R,6R)-5-acetamido-2-ethyl-6-methyl-4-[(2R)-3-oxobutan-2-yl]oxyoxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl]acetamide |
| SMILES | CCC1O[C@H](C)C(NC(C)=O)[C@@H](O[C@H](C)C(C)=O)[C@@H]1O[C@@H]1O[C@@H](CC)[C@@H](C)C(C)C1NC(C)=O |
| InChI | InChI=1S/C25H44N2O7/c1-10-19-12(3)13(4)21(26-17(8)29)25(33-19)34-23-20(11-2)31-16(7)22(27-18(9)30)24(23)32-15(6)14(5)28/h12-13,15-16,19-25H,10-11H2,1-9H3,(H,26,29)(H,27,30)/t12-,13?,15+,16+,19-,20?,21?,22?,23+,24+,25-/m0/s1 |
| InChIKey | YLJSWUNSHLRUPD-CONOSEERSA-N |
| XLogP | 2.35 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |