C19H27NO8 — CID 134433927
[3,4-diacetyloxy-6-ethyl-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate (PubChem CID 134433927) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-ethyl-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-ethyl-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134433927 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [3,4-diacetyloxy-6-ethyl-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate |
| SMILES | C#CCCC(=O)NC1C(CC)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H27NO8/c1-6-8-9-16(24)20-17-14(7-2)28-15(10-25-11(3)21)18(26-12(4)22)19(17)27-13(5)23/h1,14-15,17-19H,7-10H2,2-5H3,(H,20,24) |
| InChIKey | PFHKRKRYVXJEAG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|