C14H21F2NO6 — CID 166650062
[5-acetamido-3-acetyloxy-2-(difluoromethyl)-6-ethyloxan-4-yl] acetate (PubChem CID 166650062) has the molecular formula C14H21F2NO6 and a molecular weight of 337.32 g/mol. Its IUPAC name is [5-acetamido-3-acetyloxy-2-(difluoromethyl)-6-ethyloxan-4-yl] acetate.
| Compound Name | [5-acetamido-3-acetyloxy-2-(difluoromethyl)-6-ethyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 166650062 |
| Molecular Formula | C14H21F2NO6 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [5-acetamido-3-acetyloxy-2-(difluoromethyl)-6-ethyloxan-4-yl] acetate |
| SMILES | CCC1OC(C(F)F)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O |
| InChI | InChI=1S/C14H21F2NO6/c1-5-9-10(17-6(2)18)11(21-7(3)19)12(22-8(4)20)13(23-9)14(15)16/h9-14H,5H2,1-4H3,(H,17,18) |
| InChIKey | TTWYVPAXMYFSHC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |