C11H20N2O8S — CID 167078937
[3-acetamido-2-amino-5-hydroxy-6-(methylsulfonyloxymethyl)oxan-4-yl] acetate (PubChem CID 167078937) has the molecular formula C11H20N2O8S and a molecular weight of 340.35 g/mol. Its IUPAC name is [3-acetamido-2-amino-5-hydroxy-6-(methylsulfonyloxymethyl)oxan-4-yl] acetate.
| Compound Name | [3-acetamido-2-amino-5-hydroxy-6-(methylsulfonyloxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 167078937 |
| Molecular Formula | C11H20N2O8S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [3-acetamido-2-amino-5-hydroxy-6-(methylsulfonyloxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)NC1C(N)OC(COS(C)(=O)=O)C(O)C1OC(C)=O |
| InChI | InChI=1S/C11H20N2O8S/c1-5(14)13-8-10(20-6(2)15)9(16)7(21-11(8)12)4-19-22(3,17)18/h7-11,16H,4,12H2,1-3H3,(H,13,14) |
| InChIKey | NCUHFTOKICWIEK-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|