C17H27NO8 — CID 142653413
[(2R,3R,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(hydroxymethyl)-6-(2-prop-2-enoxyethyl)oxan-3-yl] acetate (PubChem CID 142653413) has the molecular formula C17H27NO8 and a molecular weight of 373.40 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(hydroxymethyl)-6-(2-prop-2-enoxyethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(hydroxymethyl)-6-(2-prop-2-enoxyethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 142653413 |
| Molecular Formula | C17H27NO8 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-5-acetamido-4-acetyloxy-2-(hydroxymethyl)-6-(2-prop-2-enoxyethyl)oxan-3-yl] acetate |
| SMILES | C=CCOCC[C@H]1O[C@H](CO)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H27NO8/c1-5-7-23-8-6-13-15(18-10(2)20)17(25-12(4)22)16(24-11(3)21)14(9-19)26-13/h5,13-17,19H,1,6-9H2,2-4H3,(H,18,20)/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | SJQCRVGBVVJCIR-UHDSXZAQSA-N |
| XLogP | -0.29 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|