C11H17NO9 — CID 118887942
[(3S,4S,5R,6R)-3-acetyloxy-5-carbamoyloxy-2-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate (PubChem CID 118887942) has the molecular formula C11H17NO9 and a molecular weight of 307.26 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-3-acetyloxy-5-carbamoyloxy-2-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-3-acetyloxy-5-carbamoyloxy-2-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 118887942 |
| Molecular Formula | C11H17NO9 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [(3S,4S,5R,6R)-3-acetyloxy-5-carbamoyloxy-2-hydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(N)=O)[C@@H](CO)OC(O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H17NO9/c1-4(14)18-8-7(21-11(12)17)6(3-13)20-10(16)9(8)19-5(2)15/h6-10,13,16H,3H2,1-2H3,(H2,12,17)/t6-,7-,8+,9+,10?/m1/s1 |
| InChIKey | SGRQPDPOHGDKLC-NTUKYRGVSA-N |
| XLogP | -1.98 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|