C15H26O13 — CID 125121442
(2R,3R,4S,5R)-2-[(3R,4S,5S,6R)-4,5-dihydroxy-6-[(3R,4R,5R,6R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 125121442) has the molecular formula C15H26O13 and a molecular weight of 414.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[(3R,4S,5S,6R)-4,5-dihydroxy-6-[(3R,4R,5R,6R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[(3R,4S,5S,6R)-4,5-dihydroxy-6-[(3R,4R,5R,6R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 125121442 |
| Molecular Formula | C15H26O13 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[(3R,4S,5S,6R)-4,5-dihydroxy-6-[(3R,4R,5R,6R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O[C@@H]2CO[C@@H](O)[C@H](O)[C@H]2O)OC[C@@H](O[C@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C15H26O13/c16-4-1-25-14(11(21)7(4)17)28-6-3-26-15(12(22)9(6)19)27-5-2-24-13(23)10(20)8(5)18/h4-23H,1-3H2/t4-,5-,6-,7+,8+,9-,10-,11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | JCSJTDYCNQHPRJ-BUMSPNKVSA-N |
| XLogP | -5.66 |
| TPSA | 207.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |