C20H34O17 — CID 171125263
(2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-5-hydroxy-4-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-6-[(3R,4R,5R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 171125263) has the molecular formula C20H34O17 and a molecular weight of 546.48 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-5-hydroxy-4-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-6-[(3R,4R,5R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-5-hydroxy-4-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-6-[(3R,4R,5R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 171125263 |
| Molecular Formula | C20H34O17 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-5-hydroxy-4-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-6-[(3R,4R,5R)-4,5,6-trihydroxyoxan-3-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | OC1OC[C@@H](O[C@@H]2OC[C@@H](O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[C@H]3OC[C@@H](O)[C@@H](O)[C@@H]3O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H34O17/c21-5-1-32-18(13(27)9(5)23)36-8-4-34-20(35-7-3-31-17(30)12(26)11(7)25)15(29)16(8)37-19-14(28)10(24)6(22)2-33-19/h5-30H,1-4H2/t5-,6-,7-,8-,9+,10-,11+,12-,13-,14+,15-,16+,17?,18+,19-,20+/m1/s1 |
| InChIKey | INPIFKMEQWLRCY-JBJOGQMRSA-N |
| XLogP | -7.19 |
| TPSA | 266.91 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | -7.19 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |