C10H18O8S — CID 10929340
(2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-sulfanyloxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 10929340) has the molecular formula C10H18O8S and a molecular weight of 298.31 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-sulfanyloxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-sulfanyloxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 10929340 |
| Molecular Formula | C10H18O8S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2S,3R,4S,5R)-2-[(3R,4R,5R,6S)-4,5-dihydroxy-6-sulfanyloxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O[C@@H]2CO[C@@H](S)[C@H](O)[C@H]2O)OC[C@H]1O |
| InChI | InChI=1S/C10H18O8S/c11-3-1-16-9(7(14)5(3)12)18-4-2-17-10(19)8(15)6(4)13/h3-15,19H,1-2H2/t3-,4-,5+,6+,7-,8-,9+,10+/m1/s1 |
| InChIKey | QTSCLQUISRNAFF-NGIDVMRBSA-N |
| XLogP | -3.18 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|