C10H17FO7 — CID 4631608
2-(5-fluoro-4-hydroxyoxan-3-yl)oxyoxane-3,4,5-triol (PubChem CID 4631608) has the molecular formula C10H17FO7 and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-(5-fluoro-4-hydroxyoxan-3-yl)oxyoxane-3,4,5-triol.
| Compound Name | 2-(5-fluoro-4-hydroxyoxan-3-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 4631608 |
| Molecular Formula | C10H17FO7 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(5-fluoro-4-hydroxyoxan-3-yl)oxyoxane-3,4,5-triol |
| SMILES | OC1COC(OC2COCC(F)C2O)C(O)C1O |
| InChI | InChI=1S/C10H17FO7/c11-4-1-16-3-6(7(4)13)18-10-9(15)8(14)5(12)2-17-10/h4-10,12-15H,1-3H2 |
| InChIKey | FRYQUHPUEORVAG-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |