About (6R)-2,6-bis(hydroxymethyl)morpholin-3-one
(6R)-2,6-bis(hydroxymethyl)morpholin-3-one (PubChem CID 130818161) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is (6R)-2,6-bis(hydroxymethyl)morpholin-3-one.
Molecular Properties
| Compound Name | (6R)-2,6-bis(hydroxymethyl)morpholin-3-one |
| PubChem CID | 130818161 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (6R)-2,6-bis(hydroxymethyl)morpholin-3-one |
| SMILES | O=C1NC[C@H](CO)OC1CO |
| InChI | InChI=1S/C6H11NO4/c8-2-4-1-7-6(10)5(3-9)11-4/h4-5,8-9H,1-3H2,(H,7,10)/t4-,5?/m1/s1 |
| InChIKey | WIFZVGPJKCCOME-CNZKWPKMSA-N |
| XLogP | -2.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R)-2,6-bis(hydroxymethyl)morpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,6-bis(hydroxymethyl)morpholin-3-one?
The IUPAC name of (6R)-2,6-bis(hydroxymethyl)morpholin-3-one (CID 130818161) is (6R)-2,6-bis(hydroxymethyl)morpholin-3-one.
What is the SMILES notation for (6R)-2,6-bis(hydroxymethyl)morpholin-3-one?
The canonical SMILES for (6R)-2,6-bis(hydroxymethyl)morpholin-3-one is O=C1NC[C@H](CO)OC1CO.
What is the InChIKey of (6R)-2,6-bis(hydroxymethyl)morpholin-3-one?
The InChIKey is WIFZVGPJKCCOME-CNZKWPKMSA-N. The full InChI is InChI=1S/C6H11NO4/c8-2-4-1-7-6(10)5(3-9)11-4/h4-5,8-9H,1-3H2,(H,7,10)/t4-,5?/m1/s1.
What are the key properties of (6R)-2,6-bis(hydroxymethyl)morpholin-3-one?
(6R)-2,6-bis(hydroxymethyl)morpholin-3-one has a molecular weight of 161.16 g/mol, XLogP of -2.15, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,6-bis(hydroxymethyl)morpholin-3-one is sourced from PubChem (CID 130818161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).