C6H11NO4 — CID 130818161
(6R)-2,6-bis(hydroxymethyl)morpholin-3-one (PubChem CID 130818161) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is (6R)-2,6-bis(hydroxymethyl)morpholin-3-one.
| Compound Name | (6R)-2,6-bis(hydroxymethyl)morpholin-3-one |
|---|---|
| PubChem CID | 130818161 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (6R)-2,6-bis(hydroxymethyl)morpholin-3-one |
| SMILES | O=C1NC[C@H](CO)OC1CO |
| InChI | InChI=1S/C6H11NO4/c8-2-4-1-7-6(10)5(3-9)11-4/h4-5,8-9H,1-3H2,(H,7,10)/t4-,5?/m1/s1 |
| InChIKey | WIFZVGPJKCCOME-CNZKWPKMSA-N |
| XLogP | -2.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |