About butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one
butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 143016675) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 143016675 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCC.O=C1NCC(CO)O1 |
| InChI | InChI=1S/C4H7NO3.C4H10/c6-2-3-1-5-4(7)8-3;1-3-4-2/h3,6H,1-2H2,(H,5,7);3-4H2,1-2H3 |
| InChIKey | RFAZGVYRXWAEBZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one?
The IUPAC name of butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one (CID 143016675) is butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one is CCCC.O=C1NCC(CO)O1.
What is the InChIKey of butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one?
The InChIKey is RFAZGVYRXWAEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3.C4H10/c6-2-3-1-5-4(7)8-3;1-3-4-2/h3,6H,1-2H2,(H,5,7);3-4H2,1-2H3.
What are the key properties of butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one?
butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one has a molecular weight of 175.23 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;5-(hydroxymethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 143016675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).