C6H10ClNO2 — CID 154193468
5-(2-chloropropyl)-1,3-oxazolidin-2-one (PubChem CID 154193468) has the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. Its IUPAC name is 5-(2-chloropropyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(2-chloropropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 154193468 |
| Molecular Formula | C6H10ClNO2 |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 5-(2-chloropropyl)-1,3-oxazolidin-2-one |
| SMILES | CC(Cl)CC1CNC(=O)O1 |
| InChI | InChI=1S/C6H10ClNO2/c1-4(7)2-5-3-8-6(9)10-5/h4-5H,2-3H2,1H3,(H,8,9) |
| InChIKey | AGZVNAQZBFWIMK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|