About (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane
(5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane (PubChem CID 157467427) has the molecular formula C5H11NO3S
and a molecular weight of 165.21 g/mol. Its IUPAC name is (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane.
Molecular Properties
| Compound Name | (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane |
| PubChem CID | 157467427 |
| Molecular Formula | C5H11NO3S |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane |
| SMILES | COC[C@@H]1CNC(=O)O1.S |
| InChI | InChI=1S/C5H9NO3.H2S/c1-8-3-4-2-6-5(7)9-4;/h4H,2-3H2,1H3,(H,6,7);1H2/t4-;/m0./s1 |
| InChIKey | BUQJOVQPJUZFKW-WCCKRBBISA-N |
| XLogP | -0.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane?
The IUPAC name of (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane (CID 157467427) is (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane.
What is the SMILES notation for (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane?
The canonical SMILES for (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane is COC[C@@H]1CNC(=O)O1.S.
What is the InChIKey of (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane?
The InChIKey is BUQJOVQPJUZFKW-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO3.H2S/c1-8-3-4-2-6-5(7)9-4;/h4H,2-3H2,1H3,(H,6,7);1H2/t4-;/m0./s1.
What are the key properties of (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane?
(5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane has a molecular weight of 165.21 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(methoxymethyl)-1,3-oxazolidin-2-one;sulfane is sourced from PubChem (CID 157467427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).