About potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate
potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate (PubChem CID 158990418) has the molecular formula C5H6ClKN2O3
and a molecular weight of 216.66 g/mol. Its IUPAC name is potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate.
Molecular Properties
| Compound Name | potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate |
| PubChem CID | 158990418 |
| Molecular Formula | C5H6ClKN2O3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate |
| SMILES | N#C[O-].O=C1NC[C@@H](CCl)O1.[K+] |
| InChI | InChI=1S/C4H6ClNO2.CHNO.K/c5-1-3-2-6-4(7)8-3;2-1-3;/h3H,1-2H2,(H,6,7);3H;/q;;+1/p-1/t3-;;/m1../s1 |
| InChIKey | JQCADJSNGFPKMY-HWYNEVGZSA-M |
| XLogP | -3.83 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate?
The IUPAC name of potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate (CID 158990418) is potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate.
What is the SMILES notation for potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate?
The canonical SMILES for potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate is N#C[O-].O=C1NC[C@@H](CCl)O1.[K+].
What is the InChIKey of potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate?
The InChIKey is JQCADJSNGFPKMY-HWYNEVGZSA-M. The full InChI is InChI=1S/C4H6ClNO2.CHNO.K/c5-1-3-2-6-4(7)8-3;2-1-3;/h3H,1-2H2,(H,6,7);3H;/q;;+1/p-1/t3-;;/m1../s1.
What are the key properties of potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate?
potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate has a molecular weight of 216.66 g/mol, XLogP of -3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(5S)-5-(chloromethyl)-1,3-oxazolidin-2-one;cyanate is sourced from PubChem (CID 158990418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).