C27H36O27 — CID 140513854
3,6,9,12,15,18,21,24,27-nonakis(hydroxymethyl)-1,4,7,10,13,16,19,22,25-nonaoxacycloheptacosane-2,5,8,11,14,17,20,23,26-nonone (PubChem CID 140513854) has the molecular formula C27H36O27 and a molecular weight of 792.56 g/mol. Its IUPAC name is 3,6,9,12,15,18,21,24,27-nonakis(hydroxymethyl)-1,4,7,10,13,16,19,22,25-nonaoxacycloheptacosane-2,5,8,11,14,17,20,23,26-nonone.
| Compound Name | 3,6,9,12,15,18,21,24,27-nonakis(hydroxymethyl)-1,4,7,10,13,16,19,22,25-nonaoxacycloheptacosane-2,5,8,11,14,17,20,23,26-nonone |
|---|---|
| PubChem CID | 140513854 |
| Molecular Formula | C27H36O27 |
| Molecular Weight | 792.56 g/mol |
| Exact Mass | 792.14 |
| IUPAC Name | 3,6,9,12,15,18,21,24,27-nonakis(hydroxymethyl)-1,4,7,10,13,16,19,22,25-nonaoxacycloheptacosane-2,5,8,11,14,17,20,23,26-nonone |
| SMILES | O=C1OC(CO)C(=O)OC(CO)C(=O)OC(CO)C(=O)OC(CO)C(=O)OC(CO)C(=O)OC(CO)C(=O)OC(CO)C(=O)OC(CO)C(=O)OC1CO |
| InChI | InChI=1S/C27H36O27/c28-1-10-19(37)47-12(3-30)21(39)49-14(5-32)23(41)51-16(7-34)25(43)53-18(9-36)27(45)54-17(8-35)26(44)52-15(6-33)24(42)50-13(4-31)22(40)48-11(2-29)20(38)46-10/h10-18,28-36H,1-9H2 |
| InChIKey | WWWFWVDFABMQNM-UHFFFAOYSA-N |
| XLogP | -9.86 |
| TPSA | 418.77 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.56 |
| LogP ≤ 5 | -9.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|