C17H28O9 — CID 139787802
3-hexyl-6,9-bis(hydroxymethyl)-3-(1-hydroxypropyl)-1,4,7-trioxonane-2,5,8-trione (PubChem CID 139787802) has the molecular formula C17H28O9 and a molecular weight of 376.40 g/mol. Its IUPAC name is 3-hexyl-6,9-bis(hydroxymethyl)-3-(1-hydroxypropyl)-1,4,7-trioxonane-2,5,8-trione.
| Compound Name | 3-hexyl-6,9-bis(hydroxymethyl)-3-(1-hydroxypropyl)-1,4,7-trioxonane-2,5,8-trione |
|---|---|
| PubChem CID | 139787802 |
| Molecular Formula | C17H28O9 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 3-hexyl-6,9-bis(hydroxymethyl)-3-(1-hydroxypropyl)-1,4,7-trioxonane-2,5,8-trione |
| SMILES | CCCCCCC1(C(O)CC)OC(=O)C(CO)OC(=O)C(CO)OC1=O |
| InChI | InChI=1S/C17H28O9/c1-3-5-6-7-8-17(13(20)4-2)16(23)25-11(9-18)14(21)24-12(10-19)15(22)26-17/h11-13,18-20H,3-10H2,1-2H3 |
| InChIKey | XYDPZVIGPGWZFI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|