C17H30O4 — CID 101040022
(1R,4R,5R)-1-(1-hydroxydodecyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one (PubChem CID 101040022) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (1R,4R,5R)-1-(1-hydroxydodecyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4R,5R)-1-(1-hydroxydodecyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 101040022 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (1R,4R,5R)-1-(1-hydroxydodecyl)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| SMILES | CCCCCCCCCCCC(O)[C@@]12O[C@@H]1[C@@H](C)OC2=O |
| InChI | InChI=1S/C17H30O4/c1-3-4-5-6-7-8-9-10-11-12-14(18)17-15(21-17)13(2)20-16(17)19/h13-15,18H,3-12H2,1-2H3/t13-,14?,15-,17-/m1/s1 |
| InChIKey | AJZAZBRZLUFYRS-JTRQHRHOSA-N |
| XLogP | 3.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|