C14H24O3 — CID 122661318
(2R)-4-[(1R)-1-hydroxynonyl]-2-methyl-2H-furan-5-one (PubChem CID 122661318) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2R)-4-[(1R)-1-hydroxynonyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2R)-4-[(1R)-1-hydroxynonyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 122661318 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2R)-4-[(1R)-1-hydroxynonyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCC[C@@H](O)C1=C[C@@H](C)OC1=O |
| InChI | InChI=1S/C14H24O3/c1-3-4-5-6-7-8-9-13(15)12-10-11(2)17-14(12)16/h10-11,13,15H,3-9H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | RJVWLKNDRCJCJW-DGCLKSJQSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|