C9H14O3 — CID 130123309
4-(1-hydroxybutyl)-2-methyl-2H-furan-5-one (PubChem CID 130123309) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-(1-hydroxybutyl)-2-methyl-2H-furan-5-one.
| Compound Name | 4-(1-hydroxybutyl)-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 130123309 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4-(1-hydroxybutyl)-2-methyl-2H-furan-5-one |
| SMILES | CCCC(O)C1=CC(C)OC1=O |
| InChI | InChI=1S/C9H14O3/c1-3-4-8(10)7-5-6(2)12-9(7)11/h5-6,8,10H,3-4H2,1-2H3 |
| InChIKey | AOROJXXVOKWSNE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |