C33H63N3O6 — CID 139814368
1,3,5-tris(1-hydroxydecyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 139814368) has the molecular formula C33H63N3O6 and a molecular weight of 597.88 g/mol. Its IUPAC name is 1,3,5-tris(1-hydroxydecyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(1-hydroxydecyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139814368 |
| Molecular Formula | C33H63N3O6 |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.47 |
| IUPAC Name | 1,3,5-tris(1-hydroxydecyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCCCCCCC(O)n1c(=O)n(C(O)CCCCCCCCC)c(=O)n(C(O)CCCCCCCCC)c1=O |
| InChI | InChI=1S/C33H63N3O6/c1-4-7-10-13-16-19-22-25-28(37)34-31(40)35(29(38)26-23-20-17-14-11-8-5-2)33(42)36(32(34)41)30(39)27-24-21-18-15-12-9-6-3/h28-30,37-39H,4-27H2,1-3H3 |
| InChIKey | UEVULDPEDHYDJD-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|