C11H22O2 — CID 101062225
(1S)-1-[(2R,3R)-3-ethyl-2-methyloxiran-2-yl]hexan-1-ol (PubChem CID 101062225) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (1S)-1-[(2R,3R)-3-ethyl-2-methyloxiran-2-yl]hexan-1-ol.
| Compound Name | (1S)-1-[(2R,3R)-3-ethyl-2-methyloxiran-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 101062225 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (1S)-1-[(2R,3R)-3-ethyl-2-methyloxiran-2-yl]hexan-1-ol |
| SMILES | CCCCC[C@H](O)[C@@]1(C)O[C@@H]1CC |
| InChI | InChI=1S/C11H22O2/c1-4-6-7-8-9(12)11(3)10(5-2)13-11/h9-10,12H,4-8H2,1-3H3/t9-,10+,11+/m0/s1 |
| InChIKey | QRYWWTXBJIXQNB-HBNTYKKESA-N |
| XLogP | 2.50 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|